cas: 23269-92-3 — see every product listed under this CAS number, including other names
5-(3,4,5-Trimethoxyphenyl)-1,3,4-oxadiazole-2-thiol, 98% (CAS 23269-92-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A464173-10g |
| cas | 23269-92-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4581.43 Pln | |
| AmBeed | 25g | 9379.30 Pln | |
| AmBeed | 250mg | 597.31 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 23269-92-3) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: IYUWDYZWKDQESI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | IYUWDYZWKDQESI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)