cas: 276684-04-9 — see every product listed under this CAS number, including other names
5-(3,4-Dichloro-phenyl)-1 H -pyrazole-3-carboxylic acid, 98% (CAS 276684-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027886-1G |
| cas | 276684-04-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 987.17 Pln | |
| Fluorochem | 25g | 2169.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 276684-04-9) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: KTLNOKUDBRHUIV-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | KTLNOKUDBRHUIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NNC(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)