CAS 62035-95-4 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 95%, 5-(3,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 62035-95-4) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: YGDAKLFEIFZEOO-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | YGDAKLFEIFZEOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NN=C(O2)N)Cl)Cl |
Computed by PubChem (NCBI)