CAS 941869-82-5 is the registry number for 5-(2,5-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5-(2,5-dichlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 941869-82-5) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: KBDLMNTWTPXEFZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | KBDLMNTWTPXEFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NN=C(O2)N)Cl |
Computed by PubChem (NCBI)