CAS 1935226-90-6 is the registry number for 5-(Chloromethyl)-3-(3-chloropyridin-4-yl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.
5-(chloromethyl)-3-(3-chloro-4-pyridinyl)-1,2,4-oxadiazole (CAS 1935226-90-6) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-chloro-4-pyridinyl)-1,2,4-oxadiazole. InChIKey: GGMVRJHKPGESDF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-chloro-4-pyridinyl)-1,2,4-oxadiazole |
| InChIKey | GGMVRJHKPGESDF-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=NOC(=N2)CCl)Cl |
Computed by PubChem (NCBI)