CAS 2763158-41-2 is the registry number for 2,4-Dichloro-8-methoxypyrido[3,4-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-8-methoxypyrido[3,4-d]pyrimidine (CAS 2763158-41-2) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 2,4-dichloro-8-methoxypyrido[3,4-d]pyrimidine. InChIKey: OSYOPAJJDMRGIN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 2,4-dichloro-8-methoxypyrido[3,4-d]pyrimidine |
| InChIKey | OSYOPAJJDMRGIN-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)