CAS 60160-13-6 appears in our catalog under these names: 5-(2,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(2,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 95-<97%, 5-(2,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 25g, 50g, 100g, 0,5g.
5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 60160-13-6) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: CFAKQLAZXZWZLX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | CFAKQLAZXZWZLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NN=C(O2)N |
Computed by PubChem (NCBI)