CAS 25465-57-0 is the registry number for 6,8-Dichloro-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3-methyl-1,2,3-benzotriazin-4-one (CAS 25465-57-0) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 6,8-dichloro-3-methyl-1,2,3-benzotriazin-4-one. InChIKey: BCIOBWZLXBMHTB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 6,8-dichloro-3-methyl-1,2,3-benzotriazin-4-one |
| InChIKey | BCIOBWZLXBMHTB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C(=CC(=C2)Cl)Cl)N=N1 |
Computed by PubChem (NCBI)