CAS 2618422-75-4 is the registry number for 4,6-Dichloro-1-methylpyrido[3,2-d]pyrimidin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1-methylpyrido[3,2-d]pyrimidin-2-one (CAS 2618422-75-4) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 4,6-dichloro-1-methylpyrido[3,2-d]pyrimidin-2-one. InChIKey: UOCALRAJYFPYEG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 4,6-dichloro-1-methylpyrido[3,2-d]pyrimidin-2-one |
| InChIKey | UOCALRAJYFPYEG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=NC1=O)Cl)N=C(C=C2)Cl |
Computed by PubChem (NCBI)