CAS 79604-43-6 is the registry number for 1-(2,4-Dichlorophenyl)-1H-1,2,4-triazol-5-one. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
2-(2,4-dichlorophenyl)-4H-1,2,4-triazol-3-one (CAS 79604-43-6) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-4H-1,2,4-triazol-3-one. InChIKey: AJUBKBLVURGUCN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-4H-1,2,4-triazol-3-one |
| InChIKey | AJUBKBLVURGUCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N2C(=O)NC=N2 |
Computed by PubChem (NCBI)