5-(3,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 95%
cas: 62035-95-4 — see every product listed under this CAS number, including other names
5-(3,4-Dichlorophenyl)-1,3,4-oxadiazol-2-amine, 95% (CAS 62035-95-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A542626-250mg |
| cas | 62035-95-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 3624.44 Pln | |
| BLDpharm | 250mg | 264.38 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 3901.98 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 530.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 62035-95-4) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: YGDAKLFEIFZEOO-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | YGDAKLFEIFZEOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NN=C(O2)N)Cl)Cl |
Computed by PubChem (NCBI)
