cas: 1017513-51-7 — see every product listed under this CAS number, including other names
5-(3,4-Difluorophenyl)isoxazole-3-carboxylic acid, 97% (CAS 1017513-51-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A752525-5g |
| cas | 1017513-51-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17588.41 Pln | |
| AmBeed | 10g | 25120.48 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1017513-51-7) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: GUQAHOANQYNQHL-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GUQAHOANQYNQHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NO2)C(=O)O)F)F |
Computed by PubChem (NCBI)