cas: 1557038-82-0 — see every product listed under this CAS number, including other names
5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 95+%, 95+% (CAS 1557038-82-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ASMX-250mg |
| cas | 1557038-82-0 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 410.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1557038-82-0) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: KOYVJIGBLQRTRF-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | KOYVJIGBLQRTRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)