cas: 32058-82-5 — see every product listed under this CAS number, including other names
5-(4-Aminophenyl)-1,3,4-oxadiazole-2-thiol 95% (CAS 32058-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A734143-250mg |
| cas | 32058-82-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1221.44 Pln | |
| Ambeed | 100g | 3757.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A734143 |
5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 32058-82-5) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: FIGMOSDEYMCQLX-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | FIGMOSDEYMCQLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)N |
Computed by PubChem (NCBI)