cas: 32058-82-5 — see every product listed under this CAS number, including other names
5-(4-Aminophenyl)-1,3,4-oxadiazole-2-thiol, 97%, 97% (CAS 32058-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CK7L-250mg |
| cas | 32058-82-5 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 386.00 Pln | |
| Chemat | 25g | 813.20 Pln | |
| Chemat | 100g | 2210.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 32058-82-5) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: FIGMOSDEYMCQLX-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | FIGMOSDEYMCQLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)N |
Computed by PubChem (NCBI)