cas: 33282-24-5 — see every product listed under this CAS number, including other names
5-(4-Fluoro-phenyl)-isoxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027861-250MG |
| cas | 33282-24-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1091.30 Pln | |
| Fluorochem | 1g | 1882.69 Pln | |
| Fluorochem | 5g | 8172.14 Pln | |
| Fluorochem | 50mg | 362.39 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OFWUBERMKPVMCT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | OFWUBERMKPVMCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)