cas: 33282-24-5 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)isoxazole-3-carboxylic Acid, >95.0%(HPLC)(T) (CAS 33282-24-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F1428-200MG |
| cas | 33282-24-5 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 437.97 Pln | |
| TCI | 1g | 929.69 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OFWUBERMKPVMCT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | OFWUBERMKPVMCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)