cas: 33282-24-5 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)isoxazole-3-carboxylic Acid, 95%, 95% (CAS 33282-24-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GGT-250mg |
| cas | 33282-24-5 |
| size | 250mg |
| availability | 1.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 50mg | 208.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OFWUBERMKPVMCT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | OFWUBERMKPVMCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)