5-(4-Fluorophenyl)isoxazole-3-carboxylic acid, 95%
cas: 33282-24-5 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)isoxazole-3-carboxylic acid, 95% (CAS 33282-24-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A677373-250mg |
| cas | 33282-24-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 2795.62 Pln | |
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 10g | 10437.20 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1014.11 Pln | |
| BLDpharm | 5g | 3007.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OFWUBERMKPVMCT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | OFWUBERMKPVMCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid, 5-(4-fluorophenyl)-3-isoxazolecarboxylic acid, 5-(4-fluorophenyl)isoxazole-3-carboxylic acid, 5-(4-Fluoro-phenyl)-isoxazole-3-carboxylic acid, 5-(4-fluorophenyl)-isoxazole-3-carboxylic acid, 5-(4-fluoro-phenyl)isoxazole-3-carboxylic acid, TimTec1_008201, OFWUBERMKPVMCT-UHFFFAOYSA-N, 5(4-fluorophenyl)-isoxazole-3-carboxylic acid
