cas: 566198-28-5 — see every product listed under this CAS number, including other names
5-(4-Formylphenyl)nicotinic Acid, 95%, 95% (CAS 566198-28-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M6Y-100mg |
| cas | 566198-28-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2272.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4-formylphenyl)pyridine-3-carboxylic acid (CAS 566198-28-5) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 5-(4-formylphenyl)pyridine-3-carboxylic acid. InChIKey: HXYMSAUBDZGIRE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 5-(4-formylphenyl)pyridine-3-carboxylic acid |
| InChIKey | HXYMSAUBDZGIRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)