Products 2243-80-3
CAS 2243-80-3 appears in our catalog under these names: 3–Nitrobenzophenone, 3-Nitrobenzophenone, 3-Nitrobenzophenone, 98%, (3-Nitrophenyl)(phenyl)methanone 98%, (3-Nitrophenyl)(phenyl)methanone, 98%, 98%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 50g, 100g, 10g, 1g, 100mg, 250mg.
(3-nitrophenyl)-phenylmethanone (CAS 2243-80-3) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: (3-nitrophenyl)-phenylmethanone. InChIKey: MFYLRNKOXORIPK-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (3-nitrophenyl)-phenylmethanone |
| InChIKey | MFYLRNKOXORIPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)