CAS 1869972-35-9 is the registry number for 2-Ethylnaphtho[2,1-d]oxazole-4,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethylbenzo[g][1,3]benzoxazole-4,5-dione (CAS 1869972-35-9) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 2-ethylbenzo[g][1,3]benzoxazole-4,5-dione. InChIKey: IYYCEDJUCRKKRF-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 2-ethylbenzo[g][1,3]benzoxazole-4,5-dione |
| InChIKey | IYYCEDJUCRKKRF-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(O1)C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)