cas: 57238-76-3 — see every product listed under this CAS number, including other names
5-(Chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole, 97%, 97% (CAS 57238-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDRV-100mg |
| cas | 57238-76-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1206.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 57238-76-3) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: DNEALSFRYSYSDL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | DNEALSFRYSYSDL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)