cas: 57238-76-3 — see every product listed under this CAS number, including other names
5-Chloromethyl-3-(4-methoxyphenyl)-[1,2,4]oxadiazole, 97% (CAS 57238-76-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047461-250MG |
| cas | 57238-76-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 2.5g | 810.15 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1559.89 Pln | |
| Fluorochem | 25g | 3059.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 57238-76-3) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: DNEALSFRYSYSDL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | DNEALSFRYSYSDL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)