cas: 57238-76-3 — see every product listed under this CAS number, including other names
5-(Chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole, 97% (CAS 57238-76-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A252331-1g |
| cas | 57238-76-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 551.74 Pln | |
| AmBeed | 250mg | 467.11 Pln | |
| AmBeed | 25g | 4893.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 57238-76-3) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: DNEALSFRYSYSDL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | DNEALSFRYSYSDL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)