CAS 1393179-73-1 is the registry number for 1,3-Difluoro-2-methoxy-4-nitrobenzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1,3-difluoro-2-methoxy-4-nitrobenzene (CAS 1393179-73-1) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 1,3-difluoro-2-methoxy-4-nitrobenzene. InChIKey: CWPLDAOSFHZEKL-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 1,3-difluoro-2-methoxy-4-nitrobenzene |
| InChIKey | CWPLDAOSFHZEKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)