Products 935287-88-0
CAS 935287-88-0 appears in our catalog under these names: 2,4-Difluoro-5-nitrobenzyl alcohol, 97%, (2,4-Difluoro-5-nitrophenyl)methanol, 98%, 2,4-Difluoro-5-nitrobenzyl alcohol, (2,4-Difluoro-5-nitrophenyl)methanol, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
(2,4-difluoro-5-nitrophenyl)methanol (CAS 935287-88-0) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: (2,4-difluoro-5-nitrophenyl)methanol. InChIKey: VPJNXLNSNZEHSQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | (2,4-difluoro-5-nitrophenyl)methanol |
| InChIKey | VPJNXLNSNZEHSQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)CO |
Computed by PubChem (NCBI)