CAS 1378491-35-0 is the registry number for 3,5-Difluoro-2-nitrobenzyl alcohol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(3,5-difluoro-2-nitrophenyl)methanol (CAS 1378491-35-0) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: (3,5-difluoro-2-nitrophenyl)methanol. InChIKey: KZQNMHJNCFINIV-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | (3,5-difluoro-2-nitrophenyl)methanol |
| InChIKey | KZQNMHJNCFINIV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)