CAS 175203-69-7 appears in our catalog under these names: 5–(Phenylethynyl)nicotinic acid, 5-(2-Phenyleth-1-ynyl)nicotinic acid, 97% , 5-(Phenylethynyl)nicotinic acid, 95%, 95%, 5-(2-Phenyleth-1-ynyl)nicotinic acid, 98%. Offered by: GLPBio, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 100mg, 250MG, 1g, 5g, 10g.
5-(2-phenylethynyl)pyridine-3-carboxylic acid (CAS 175203-69-7) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 5-(2-phenylethynyl)pyridine-3-carboxylic acid. InChIKey: DXJZBANECHYHRT-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 5-(2-phenylethynyl)pyridine-3-carboxylic acid |
| InChIKey | DXJZBANECHYHRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)