CAS 149506-93-4 appears in our catalog under these names: 4'-Cyanobiphenyl-3-carboxylic acid, 96%, 4'-Cyano-biphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-(4-cyanophenyl)benzoic acid (CAS 149506-93-4) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 3-(4-cyanophenyl)benzoic acid. InChIKey: WLUGFHVTVXLVFB-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-(4-cyanophenyl)benzoic acid |
| InChIKey | WLUGFHVTVXLVFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)