CAS 253878-93-2 is the registry number for 3'-Cyanobiphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(3-cyanophenyl)benzoic acid (CAS 253878-93-2) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 3-(3-cyanophenyl)benzoic acid. InChIKey: BFOFVXTZGJGLES-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-(3-cyanophenyl)benzoic acid |
| InChIKey | BFOFVXTZGJGLES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)C#N |
Computed by PubChem (NCBI)