CAS 893736-75-9 appears in our catalog under these names: 2'-Cyanobiphenyl-3-carboxylic acid, 98%, 2'-Cyano-(1,1'-biphenyl)-3-carboxylic acid, 98%, 2'-Cyano-[1,1'-biphenyl]-3-carboxylic acid, 98%, 98%, 2'-Cyano[1,1'-biphenyl]-3-carboxylic acid, 98%, 2'-Cyano-[1,1'-biphenyl]-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
3-(2-cyanophenyl)benzoic acid (CAS 893736-75-9) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 3-(2-cyanophenyl)benzoic acid. InChIKey: VRVHOPQLBGJNCG-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-(2-cyanophenyl)benzoic acid |
| InChIKey | VRVHOPQLBGJNCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)