CAS 29338-47-4 appears in our catalog under these names: 1-Nitro-3-(phenylethynyl)benzene, 95%, 1–Nitro–3–(phenylethynyl)benzene. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 25g, 5g.
1-nitro-3-(2-phenylethynyl)benzene (CAS 29338-47-4) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 1-nitro-3-(2-phenylethynyl)benzene. InChIKey: WIDIJEWZZQPARQ-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1-nitro-3-(2-phenylethynyl)benzene |
| InChIKey | WIDIJEWZZQPARQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)