CAS 63648-38-4 appears in our catalog under these names: 4-Isocyanatobenzophenone, 95%, (4-Isocyanatophenyl)(phenyl)methanone 95%, (4-Isocyanatophenyl)phenylmethanone, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
(4-isocyanatophenyl)-phenylmethanone (CAS 63648-38-4) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: (4-isocyanatophenyl)-phenylmethanone. InChIKey: UUUAWYNSKSCNMD-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | (4-isocyanatophenyl)-phenylmethanone |
| InChIKey | UUUAWYNSKSCNMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N=C=O |
Computed by PubChem (NCBI)