cas: 22094-61-7 — see every product listed under this CAS number, including other names
5-Aminobenzo[d]isothiazol-3(2H)-one 1,1-dioxide 97% (CAS 22094-61-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A583731-100mg |
| cas | 22094-61-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 1g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A583731 |
5-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22094-61-7) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 5-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: XHLASMNHDRLNJQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 5-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | XHLASMNHDRLNJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)