cas: 861106-93-6 — see every product listed under this CAS number, including other names
5-BROMO-1,4-DIHYDRO-2H-BENZO[D][1,3]OXAZIN-2-ONE (CAS 861106-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F536804-250MG |
| cas | 861106-93-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1231.88 Pln | |
| Fluorochem | 1g | 2106.57 Pln | |
| Fluorochem | 5g | 5782.36 Pln | |
| Fluorochem | 10g | 9666.41 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-1,4-dihydro-3,1-benzoxazin-2-one (CAS 861106-93-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: XZVJGIWTWBRGBL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | XZVJGIWTWBRGBL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)NC(=O)O1 |
Computed by PubChem (NCBI)