cas: 861106-93-6 — see every product listed under this CAS number, including other names
5-Bromo-1,4-dihydro-2h-benzo[d][1,3]oxazin-2-one, ≥95%, ≥95% (CAS 861106-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DD5K-100mg |
| cas | 861106-93-6 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1288.40 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| Chemat | 10g | 5853.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,4-dihydro-3,1-benzoxazin-2-one (CAS 861106-93-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: XZVJGIWTWBRGBL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | XZVJGIWTWBRGBL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)NC(=O)O1 |
Computed by PubChem (NCBI)