5-Bromo-1,3-dichloroisoquinoline, 95%
cas: 1215767-89-7 — see every product listed under this CAS number, including other names
5-Bromo-1,3-dichloroisoquinoline, 95% (CAS 1215767-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A118546-250mg |
| cas | 1215767-89-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1799.94 Pln | |
| Ambeed | 10g | 2840.12 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1936.01 Pln | |
| BLDpharm | 10g | 3057.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-1,3-dichloroisoquinoline (CAS 1215767-89-7) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 5-bromo-1,3-dichloroisoquinoline. InChIKey: MXMAGOOGDCWION-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 5-bromo-1,3-dichloroisoquinoline |
| InChIKey | MXMAGOOGDCWION-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)