cas: 351005-12-4 — see every product listed under this CAS number, including other names
5-Bromo-1,3-dihydrobenzo[c]thiophene 2,2-dioxide, 97%, 97% (CAS 351005-12-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CM59-25mg |
| cas | 351005-12-4 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 280.40 Pln | |
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 500mg | 1120.40 Pln | |
| Chemat | 1g | 2070.80 Pln | |
| Chemat | 5g | 7288.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,3-dihydro-2-benzothiophene 2,2-dioxide (CAS 351005-12-4) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 5-bromo-1,3-dihydro-2-benzothiophene 2,2-dioxide. InChIKey: QRJKMGQWHAQEST-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 5-bromo-1,3-dihydro-2-benzothiophene 2,2-dioxide |
| InChIKey | QRJKMGQWHAQEST-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)