CAS 1818257-71-4 appears in our catalog under these names: (1S,2S)-Rel-2-(5-bromothiophen-2-yl)cyclopropane-1-carboxylic acid, 95%, (1S,2S)-2-(5-Bromothiophen-2-yl)cyclopropanecarboxylic acid, 97%, trans-2-(5-Bromothiophen-2-yl)cyclopropane-1-carboxylic acid, (1S,2S)-rel-2-(5-bromothiophen-2-yl)cyclopropane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg.
Trans-(1S,2S)-2-(5-bromothiophen-2-yl)cyclopropane-1-carboxylic acid (CAS 1818257-71-4) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: trans-(1S,2S)-2-(5-bromothiophen-2-yl)cyclopropane-1-carboxylic acid. InChIKey: RZYSPHTVUJNTOY-WHFBIAKZSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | trans-(1S,2S)-2-(5-bromothiophen-2-yl)cyclopropane-1-carboxylic acid |
| InChIKey | RZYSPHTVUJNTOY-WHFBIAKZSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)