Products 1785446-24-3

CAS 1785446-24-3 is the registry number for 5-Bromo-4-(methylthio)benzo[d][1,3]dioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-bromo-4-methylsulfanyl-1,3-benzodioxole (CAS 1785446-24-3) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 5-bromo-4-methylsulfanyl-1,3-benzodioxole. InChIKey: VGMXUPKCPGSQKI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO2S
Molecular weight247.11 g/mol
IUPAC name5-bromo-4-methylsulfanyl-1,3-benzodioxole
InChIKeyVGMXUPKCPGSQKI-UHFFFAOYSA-N
SMILESCSC1=C(C=CC2=C1OCO2)Br

Computed by PubChem (NCBI)