CAS 91150-58-2 is the registry number for Methyl 3-(4-bromo-thiophen-2-yl)-acrylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate (CAS 91150-58-2) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: methyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate. InChIKey: OPKVLLQCBXEGTN-NSCUHMNNSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | methyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate |
| InChIKey | OPKVLLQCBXEGTN-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CS1)Br |
Computed by PubChem (NCBI)