Products 3996-39-2
CAS 3996-39-2 appears in our catalog under these names: 2-(3-Bromophenyl)ethanethioic O-acid, 97%, (3-Bromo-phenylsulfanyl)-acetic acid, 95%, m-Bromophenylmercaptoacetic acid, 3-Bromo-phenylthioacetic acid. Offered by: AmBeed, Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, on request, 0,5g.
2-(3-bromophenyl)sulfanylacetic acid (CAS 3996-39-2) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 2-(3-bromophenyl)sulfanylacetic acid. InChIKey: UNNRBTRSXFWJTG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 2-(3-bromophenyl)sulfanylacetic acid |
| InChIKey | UNNRBTRSXFWJTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)SCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[(3-bromophenyl)sulfanyl]acetic acid, 2-[(3-Bromophenyl)thio]acetic acid, 2-((3-Bromophenyl)sulfanyl)acetic acid, (3-Bromo-phenylsulfanyl)-acetic acid, 2-(3-bromophenyl)sulfanylacetic acid, 3-Bromo-phenylthioacetic acid, 2-(3-Bromophenyl)ethanethioic O-acid, 3-Bromophenylthioacetic acid, M-Bromophenylmercaptoacetic Acid, UNNRBTRSXFWJTG-UHFFFAOYSA-N