Products 1818257-30-5

CAS 1818257-30-5 is the registry number for Trans-2-(4-bromothiophen-2-yl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid (CAS 1818257-30-5) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid. InChIKey: VUGPCJZSPUEEBE-PHDIDXHHSA-N.

Identity
Molecular formulaC8H7BrO2S
Molecular weight247.11 g/mol
IUPAC nametrans-(1R,2R)-2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid
InChIKeyVUGPCJZSPUEEBE-PHDIDXHHSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=CC(=CS2)Br

Computed by PubChem (NCBI)