CAS 851334-60-6 appears in our catalog under these names: 4-Bromo-3-(methylthio)benzoic acid, 95%, 4-bromo-3-(methylthio)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.
4-bromo-3-methylsulfanylbenzoic acid (CAS 851334-60-6) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 4-bromo-3-methylsulfanylbenzoic acid. InChIKey: RHYDEIRJFPKZAE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 4-bromo-3-methylsulfanylbenzoic acid |
| InChIKey | RHYDEIRJFPKZAE-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)