CAS 62176-40-3 appears in our catalog under these names: 5-Bromo-2-(methylsulfanyl)benzoic acid, 98%, 5-Bromo-2-(methylthio)benzoic acid, 97%, 5-Bromo-2-(methylsulfanyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-bromo-2-methylsulfanylbenzoic acid (CAS 62176-40-3) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 5-bromo-2-methylsulfanylbenzoic acid. InChIKey: JRDNZLIFVSCBHM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 5-bromo-2-methylsulfanylbenzoic acid |
| InChIKey | JRDNZLIFVSCBHM-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)