cas: 7254-19-5 — see every product listed under this CAS number, including other names
5-Bromo-1H-indole-2-carboxylic acid 98% (CAS 7254-19-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182595-250mg |
| cas | 7254-19-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 370.38 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1716.50 Pln | |
| Ambeed | 500g | 8285.81 Pln | |
| Ambeed | 1000g | 14043.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182595 |
5-bromo-1H-indole-2-carboxylic acid (CAS 7254-19-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-2-carboxylic acid. InChIKey: YAULOOYNCJDPPU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-2-carboxylic acid |
| InChIKey | YAULOOYNCJDPPU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)