cas: 7254-19-5 — see every product listed under this CAS number, including other names
5-Bromoindole-2-carboxylic acid, 98% (CAS 7254-19-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250MG, 500g. Offered by: Combi-blocks, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OS-2024-10g |
| cas | 7254-19-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Thermo Scientific (Acros) | 1g | 449.90 Pln | |
| Thermo Scientific (Acros) | 5g | 1492.24 Pln | |
| Thermo Scientific (Acros) | 250MG | 164.81 Pln | |
| Sigma-Aldrich | 1G | 606.00 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 362.39 Pln | |
| Fluorochem | 500g | 1299.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-bromo-1H-indole-2-carboxylic acid (CAS 7254-19-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-2-carboxylic acid. InChIKey: YAULOOYNCJDPPU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-2-carboxylic acid |
| InChIKey | YAULOOYNCJDPPU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)