cas: 97901-15-0 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydro-1H-indene-2-carboxylic acid, 96%, 96% (CAS 97901-15-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJZR-50mg |
| cas | 97901-15-0 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 467.60 Pln | |
| Chemat | 100mg | 635.60 Pln | |
| Chemat | 250mg | 1067.60 Pln | |
| Chemat | 1g | 3002.00 Pln | |
| Chemat | 5g | 10360.40 Pln | |
| Chemat | 10g | 16538.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 97901-15-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: OMJPTHPPEYUYLP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | OMJPTHPPEYUYLP-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)