cas: 41177-72-4 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydrobenzo[b]furan-7-carboxylic acid, 97%, Variable anhydride content (CAS 41177-72-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO07139DA |
| cas | 41177-72-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 201.60 Pln | |
| Thermo Scientific | 5g | 799.26 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 41177-72-4) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: LEBMKAXASFPSFA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | LEBMKAXASFPSFA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)O)Br |
Computed by PubChem (NCBI)